C22H28N2O3 — CID 141117170
N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide (PubChem CID 141117170) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide.
| Compound Name | N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 141117170 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(N)=O)C(=O)N[C@H](c1cccc2ccccc12)C1(O)CCCCC1 |
| InChI | InChI=1S/C22H28N2O3/c1-21(2,19(23)25)20(26)24-18(22(27)13-6-3-7-14-22)17-12-8-10-15-9-4-5-11-16(15)17/h4-5,8-12,18,27H,3,6-7,13-14H2,1-2H3,(H2,23,25)(H,24,26)/t18-/m1/s1 |
| InChIKey | NWHOMWCJIRFLJE-GOSISDBHSA-N |
| XLogP | 3.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|