About N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide
N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide (PubChem CID 141117170) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide.
Molecular Properties
| Compound Name | N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide |
| PubChem CID | 141117170 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(N)=O)C(=O)N[C@H](c1cccc2ccccc12)C1(O)CCCCC1 |
| InChI | InChI=1S/C22H28N2O3/c1-21(2,19(23)25)20(26)24-18(22(27)13-6-3-7-14-22)17-12-8-10-15-9-4-5-11-16(15)17/h4-5,8-12,18,27H,3,6-7,13-14H2,1-2H3,(H2,23,25)(H,24,26)/t18-/m1/s1 |
| InChIKey | NWHOMWCJIRFLJE-GOSISDBHSA-N |
| XLogP | 3.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide?
The IUPAC name of N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide (CID 141117170) is N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide.
What is the SMILES notation for N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide?
The canonical SMILES for N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide is CC(C)(C(N)=O)C(=O)N[C@H](c1cccc2ccccc12)C1(O)CCCCC1.
What is the InChIKey of N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide?
The InChIKey is NWHOMWCJIRFLJE-GOSISDBHSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-21(2,19(23)25)20(26)24-18(22(27)13-6-3-7-14-22)17-12-8-10-15-9-4-5-11-16(15)17/h4-5,8-12,18,27H,3,6-7,13-14H2,1-2H3,(H2,23,25)(H,24,26)/t18-/m1/s1.
What are the key properties of N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide?
N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide has a molecular weight of 368.48 g/mol, XLogP of 3.20, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(R)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dimethylpropanediamide is sourced from PubChem (CID 141117170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).