C33H38N2O4 — CID 23140848
N,N'-bis(2-hydroxy-2-methyl-1-naphthalen-1-ylpropyl)-2,2-dimethylpropanediamide (PubChem CID 23140848) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is N,N'-bis(2-hydroxy-2-methyl-1-naphthalen-1-ylpropyl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(2-hydroxy-2-methyl-1-naphthalen-1-ylpropyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140848 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N,N'-bis(2-hydroxy-2-methyl-1-naphthalen-1-ylpropyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NC(c1cccc2ccccc12)C(C)(C)O)C(=O)NC(c1cccc2ccccc12)C(C)(C)O |
| InChI | InChI=1S/C33H38N2O4/c1-31(2,29(36)34-27(32(3,4)38)25-19-11-15-21-13-7-9-17-23(21)25)30(37)35-28(33(5,6)39)26-20-12-16-22-14-8-10-18-24(22)26/h7-20,27-28,38-39H,1-6H3,(H,34,36)(H,35,37) |
| InChIKey | DOKTWBBYXZRZSG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|