C75H66N2O4 — CID 87160809
2,2-diethyl-N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide (PubChem CID 87160809) has the molecular formula C75H66N2O4 and a molecular weight of 1059.36 g/mol. Its IUPAC name is 2,2-diethyl-N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide.
| Compound Name | 2,2-diethyl-N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide |
|---|---|
| PubChem CID | 87160809 |
| Molecular Formula | C75H66N2O4 |
| Molecular Weight | 1059.36 g/mol |
| Exact Mass | 1058.50 |
| IUPAC Name | 2,2-diethyl-N,N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]propanediamide |
| SMILES | CCC(CC)(C(=O)N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1)C(=O)N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C75H66N2O4/c1-3-73(4-2,71(78)76-69(67-33-17-29-59-23-13-15-31-65(59)67)74(80,47-51-35-39-55-19-5-9-25-61(55)43-51)48-52-36-40-56-20-6-10-26-62(56)44-52)72(79)77-70(68-34-18-30-60-24-14-16-32-66(60)68)75(81,49-53-37-41-57-21-7-11-27-63(57)45-53)50-54-38-42-58-22-8-12-28-64(58)46-54/h5-46,69-70,80-81H,3-4,47-50H2,1-2H3,(H,76,78)(H,77,79)/t69-,70-/m0/s1 |
| InChIKey | DYHJXYWITPCLGJ-LAZBEUIPSA-N |
| XLogP | 15.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.36 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|