C64H66N2O4 — CID 87160823
1-N,1-N'-bis[(1S)-2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-1-naphthalen-1-ylpropyl]cyclohexane-1,1-dicarboxamide (PubChem CID 87160823) has the molecular formula C64H66N2O4 and a molecular weight of 927.24 g/mol. Its IUPAC name is 1-N,1-N'-bis[(1S)-2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-1-naphthalen-1-ylpropyl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(1S)-2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-1-naphthalen-1-ylpropyl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 87160823 |
| Molecular Formula | C64H66N2O4 |
| Molecular Weight | 927.24 g/mol |
| Exact Mass | 926.50 |
| IUPAC Name | 1-N,1-N'-bis[(1S)-2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-1-naphthalen-1-ylpropyl]cyclohexane-1,1-dicarboxamide |
| SMILES | Cc1ccc(CC(O)(Cc2ccc(C)cc2)[C@@H](NC(=O)C2(C(=O)N[C@@H](c3cccc4ccccc34)C(O)(Cc3ccc(C)cc3)Cc3ccc(C)cc3)CCCCC2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C64H66N2O4/c1-44-22-30-48(31-23-44)40-63(69,41-49-32-24-45(2)25-33-49)58(56-20-12-16-52-14-6-8-18-54(52)56)65-60(67)62(38-10-5-11-39-62)61(68)66-59(57-21-13-17-53-15-7-9-19-55(53)57)64(70,42-50-34-26-46(3)27-35-50)43-51-36-28-47(4)29-37-51/h6-9,12-37,58-59,69-70H,5,10-11,38-43H2,1-4H3,(H,65,67)(H,66,68)/t58-,59-/m0/s1 |
| InChIKey | KIKJSUVOEFMCMC-LYJOYROPSA-N |
| XLogP | 12.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.24 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|