C62H62N2O4 — CID 66807797
1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclobutane-1,1-dicarboxamide (PubChem CID 66807797) has the molecular formula C62H62N2O4 and a molecular weight of 899.19 g/mol. Its IUPAC name is 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807797 |
| Molecular Formula | C62H62N2O4 |
| Molecular Weight | 899.19 g/mol |
| Exact Mass | 898.47 |
| IUPAC Name | 1-N',1-N'-bis[2-hydroxy-3-(4-methylphenyl)-2-[(4-methylphenyl)methyl]-3-naphthalen-1-ylpropyl]cyclobutane-1,1-dicarboxamide |
| SMILES | Cc1ccc(CC(O)(CN(CC(O)(Cc2ccc(C)cc2)C(c2ccc(C)cc2)c2cccc3ccccc23)C(=O)C2(C(N)=O)CCC2)C(c2ccc(C)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C62H62N2O4/c1-42-20-28-46(29-21-42)38-61(67,56(50-32-24-44(3)25-33-50)54-18-9-14-48-12-5-7-16-52(48)54)40-64(59(66)60(58(63)65)36-11-37-60)41-62(68,39-47-30-22-43(2)23-31-47)57(51-34-26-45(4)27-35-51)55-19-10-15-49-13-6-8-17-53(49)55/h5-10,12-35,56-57,67-68H,11,36-41H2,1-4H3,(H2,63,65) |
| InChIKey | ZRVDVLPIMFPWME-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.19 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|