C35H36N2O4 — CID 66807886
1-N',1-N'-bis[(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide (PubChem CID 66807886) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is 1-N',1-N'-bis[(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-bis[(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807886 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 1-N',1-N'-bis[(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopentane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(C(c2cccc3ccccc23)C2(O)CC2)C(c2cccc3ccccc23)C2(O)CC2)CCCC1 |
| InChI | InChI=1S/C35H36N2O4/c36-31(38)33(17-5-6-18-33)32(39)37(29(34(40)19-20-34)27-15-7-11-23-9-1-3-13-25(23)27)30(35(41)21-22-35)28-16-8-12-24-10-2-4-14-26(24)28/h1-4,7-16,29-30,40-41H,5-6,17-22H2,(H2,36,38) |
| InChIKey | YJVMYOXTNRQETL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|