C33H32N2O4 — CID 66807786
1-N,1-N'-bis[(S)-(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 66807786) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-N,1-N'-bis[(S)-(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(S)-(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66807786 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-N,1-N'-bis[(S)-(1-hydroxycyclopropyl)-naphthalen-1-ylmethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(N[C@@H](c1cccc2ccccc12)C1(O)CC1)C1(C(=O)N[C@@H](c2cccc3ccccc23)C2(O)CC2)CC1 |
| InChI | InChI=1S/C33H32N2O4/c36-29(34-27(32(38)17-18-32)25-13-5-9-21-7-1-3-11-23(21)25)31(15-16-31)30(37)35-28(33(39)19-20-33)26-14-6-10-22-8-2-4-12-24(22)26/h1-14,27-28,38-39H,15-20H2,(H,34,36)(H,35,37)/t27-,28-/m0/s1 |
| InChIKey | MSNMAXPLWLIWNA-NSOVKSMOSA-N |
| XLogP | 4.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|