C43H54N2O4 — CID 66807872
N,N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dipropylpropanediamide (PubChem CID 66807872) has the molecular formula C43H54N2O4 and a molecular weight of 662.92 g/mol. Its IUPAC name is N,N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dipropylpropanediamide.
| Compound Name | N,N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dipropylpropanediamide |
|---|---|
| PubChem CID | 66807872 |
| Molecular Formula | C43H54N2O4 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | N,N'-bis[(S)-(1-hydroxycyclohexyl)-naphthalen-1-ylmethyl]-2,2-dipropylpropanediamide |
| SMILES | CCCC(CCC)(C(=O)N[C@@H](c1cccc2ccccc12)C1(O)CCCCC1)C(=O)N[C@@H](c1cccc2ccccc12)C1(O)CCCCC1 |
| InChI | InChI=1S/C43H54N2O4/c1-3-25-41(26-4-2,39(46)44-37(42(48)27-11-5-12-28-42)35-23-15-19-31-17-7-9-21-33(31)35)40(47)45-38(43(49)29-13-6-14-30-43)36-24-16-20-32-18-8-10-22-34(32)36/h7-10,15-24,37-38,48-49H,3-6,11-14,25-30H2,1-2H3,(H,44,46)(H,45,47)/t37-,38-/m0/s1 |
| InChIKey | GLDPNSRDCLDBFH-UWXQCODUSA-N |
| XLogP | 8.98 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|