C28H38N2O4 — CID 174524452
butyl-[1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]piperidin-4-yl]carbamic acid (PubChem CID 174524452) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is butyl-[1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]piperidin-4-yl]carbamic acid.
| Compound Name | butyl-[1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174524452 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | butyl-[1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]piperidin-4-yl]carbamic acid |
| SMILES | CCCCN(C(=O)O)C1CCN(C(=O)C(c2cccc3ccccc23)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C28H38N2O4/c1-2-3-18-30(27(32)33)22-14-19-29(20-15-22)26(31)25(28(34)16-7-4-8-17-28)24-13-9-11-21-10-5-6-12-23(21)24/h5-6,9-13,22,25,34H,2-4,7-8,14-20H2,1H3,(H,32,33) |
| InChIKey | QXPPZZMSSWFWJB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |