C19H25FN2O4 — CID 174524081
4-[2-(2-fluorophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylic acid (PubChem CID 174524081) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-(2-fluorophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174524081 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[2-(2-fluorophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)C(c2ccccc2F)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C19H25FN2O4/c20-15-7-3-2-6-14(15)16(19(26)8-4-1-5-9-19)17(23)21-10-12-22(13-11-21)18(24)25/h2-3,6-7,16,26H,1,4-5,8-13H2,(H,24,25) |
| InChIKey | OLVDADIUIGCAKA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |