C27H36N2O3 — CID 91024951
4-[2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]ethyl]piperazine-1-carboxylic acid (PubChem CID 91024951) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]ethyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 91024951 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-[2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]ethyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(CC(c2ccc(CCc3ccccc3)cc2)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C27H36N2O3/c30-26(31)29-19-17-28(18-20-29)21-25(27(32)15-5-2-6-16-27)24-13-11-23(12-14-24)10-9-22-7-3-1-4-8-22/h1,3-4,7-8,11-14,25,32H,2,5-6,9-10,15-21H2,(H,30,31) |
| InChIKey | AWKSFAVODFEZBW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |