C22H26O3 — CID 68855874
2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]acetic acid (PubChem CID 68855874) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]acetic acid.
| Compound Name | 2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 68855874 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-2-[4-(2-phenylethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(c1ccc(CCc2ccccc2)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C22H26O3/c23-21(24)20(22(25)15-5-2-6-16-22)19-13-11-18(12-14-19)10-9-17-7-3-1-4-8-17/h1,3-4,7-8,11-14,20,25H,2,5-6,9-10,15-16H2,(H,23,24) |
| InChIKey | VQFCGTMPBSTTCK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |