C15H19BrO4 — CID 68854196
2-(3-bromo-4-methoxyphenyl)-2-(1-hydroxycyclohexyl)acetic acid (PubChem CID 68854196) has the molecular formula C15H19BrO4 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-2-(1-hydroxycyclohexyl)acetic acid.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-2-(1-hydroxycyclohexyl)acetic acid |
|---|---|
| PubChem CID | 68854196 |
| Molecular Formula | C15H19BrO4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-2-(1-hydroxycyclohexyl)acetic acid |
| SMILES | COc1ccc(C(C(=O)O)C2(O)CCCCC2)cc1Br |
| InChI | InChI=1S/C15H19BrO4/c1-20-12-6-5-10(9-11(12)16)13(14(17)18)15(19)7-3-2-4-8-15/h5-6,9,13,19H,2-4,7-8H2,1H3,(H,17,18) |
| InChIKey | RFAVVUUOJOKONU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |