C13H18BrNO3 — CID 116908055
3-(3-bromo-4-methoxyphenyl)-3-(dimethylamino)-2-methylpropanoic acid (PubChem CID 116908055) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-3-(dimethylamino)-2-methylpropanoic acid.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-3-(dimethylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 116908055 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-3-(dimethylamino)-2-methylpropanoic acid |
| SMILES | COc1ccc(C(C(C)C(=O)O)N(C)C)cc1Br |
| InChI | InChI=1S/C13H18BrNO3/c1-8(13(16)17)12(15(2)3)9-5-6-11(18-4)10(14)7-9/h5-8,12H,1-4H3,(H,16,17) |
| InChIKey | ATDJGFFLOJWRLR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |