C13H19BrN2O3 — CID 116911882
3-amino-4-(3-bromo-4-methoxyphenyl)-4-(dimethylamino)butanoic acid (PubChem CID 116911882) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-amino-4-(3-bromo-4-methoxyphenyl)-4-(dimethylamino)butanoic acid.
| Compound Name | 3-amino-4-(3-bromo-4-methoxyphenyl)-4-(dimethylamino)butanoic acid |
|---|---|
| PubChem CID | 116911882 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-amino-4-(3-bromo-4-methoxyphenyl)-4-(dimethylamino)butanoic acid |
| SMILES | COc1ccc(C(C(N)CC(=O)O)N(C)C)cc1Br |
| InChI | InChI=1S/C13H19BrN2O3/c1-16(2)13(10(15)7-12(17)18)8-4-5-11(19-3)9(14)6-8/h4-6,10,13H,7,15H2,1-3H3,(H,17,18) |
| InChIKey | OJVHDQQAXSHBKH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |