C14H17FO3 — CID 129389781
(2S)-2-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetic acid (PubChem CID 129389781) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetic acid.
| Compound Name | (2S)-2-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetic acid |
|---|---|
| PubChem CID | 129389781 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetic acid |
| SMILES | O=C(O)[C@@H](c1ccc(F)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C14H17FO3/c15-11-6-4-10(5-7-11)12(13(16)17)14(18)8-2-1-3-9-14/h4-7,12,18H,1-3,8-9H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | ANBHLAKHKGRRBF-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |