C16H18O3S — CID 129386935
(2R)-2-(1-benzothiophen-3-yl)-2-(1-hydroxycyclohexyl)acetic acid (PubChem CID 129386935) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (2R)-2-(1-benzothiophen-3-yl)-2-(1-hydroxycyclohexyl)acetic acid.
| Compound Name | (2R)-2-(1-benzothiophen-3-yl)-2-(1-hydroxycyclohexyl)acetic acid |
|---|---|
| PubChem CID | 129386935 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (2R)-2-(1-benzothiophen-3-yl)-2-(1-hydroxycyclohexyl)acetic acid |
| SMILES | O=C(O)[C@H](c1csc2ccccc12)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H18O3S/c17-15(18)14(16(19)8-4-1-5-9-16)12-10-20-13-7-3-2-6-11(12)13/h2-3,6-7,10,14,19H,1,4-5,8-9H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | FKRGTRQGXXASSN-AWEZNQCLSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |