C15H17F3O4 — CID 68852749
2-(1-hydroxycyclohexyl)-2-[4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 68852749) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-2-[4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-(1-hydroxycyclohexyl)-2-[4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 68852749 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-2-[4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)C(c1ccc(OC(F)(F)F)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C15H17F3O4/c16-15(17,18)22-11-6-4-10(5-7-11)12(13(19)20)14(21)8-2-1-3-9-14/h4-7,12,21H,1-3,8-9H2,(H,19,20) |
| InChIKey | UQXFLQAZOOTXEZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |