C14H14F3NO2 — CID 79136457
1-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]cyclopentane-1-carbonitrile (PubChem CID 79136457) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79136457 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]cyclopentane-1-carbonitrile |
| SMILES | N#CC1(C(O)c2ccc(OC(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)20-11-5-3-10(4-6-11)12(19)13(9-18)7-1-2-8-13/h3-6,12,19H,1-2,7-8H2 |
| InChIKey | MYWUACCRBKZRKE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |