C20H19F6NO3 — CID 16656274
4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol (PubChem CID 16656274) has the molecular formula C20H19F6NO3 and a molecular weight of 435.36 g/mol. Its IUPAC name is 4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol.
| Compound Name | 4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 16656274 |
| Molecular Formula | C20H19F6NO3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol |
| SMILES | OC1(C(c2ccc(OC(F)(F)F)cc2)c2ccc(OC(F)(F)F)cc2)CCNCC1 |
| InChI | InChI=1S/C20H19F6NO3/c21-19(22,23)29-15-5-1-13(2-6-15)17(18(28)9-11-27-12-10-18)14-3-7-16(8-4-14)30-20(24,25)26/h1-8,17,27-28H,9-12H2 |
| InChIKey | QIAIHLMAMZYTCT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |