C27H25F6NO3 — CID 11497364
1-benzyl-4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol (PubChem CID 11497364) has the molecular formula C27H25F6NO3 and a molecular weight of 525.49 g/mol. Its IUPAC name is 1-benzyl-4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-benzyl-4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 11497364 |
| Molecular Formula | C27H25F6NO3 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 1-benzyl-4-[bis[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-ol |
| SMILES | OC1(C(c2ccc(OC(F)(F)F)cc2)c2ccc(OC(F)(F)F)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H25F6NO3/c28-26(29,30)36-22-10-6-20(7-11-22)24(21-8-12-23(13-9-21)37-27(31,32)33)25(35)14-16-34(17-15-25)18-19-4-2-1-3-5-19/h1-13,24,35H,14-18H2 |
| InChIKey | IOCGAUXGXBMQGX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |