C19H27F3N2O2 — CID 11176215
1-[2-piperazin-1-yl-1-[4-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol (PubChem CID 11176215) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[2-piperazin-1-yl-1-[4-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-piperazin-1-yl-1-[4-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11176215 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[2-piperazin-1-yl-1-[4-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
| SMILES | OC1(C(CN2CCNCC2)c2ccc(OC(F)(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C19H27F3N2O2/c20-19(21,22)26-16-6-4-15(5-7-16)17(14-24-12-10-23-11-13-24)18(25)8-2-1-3-9-18/h4-7,17,23,25H,1-3,8-14H2 |
| InChIKey | UTQUIHWPWAIHSN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |