C21H34N2O2 — CID 21241517
1-[1-(4-methoxyphenyl)-4-piperazin-1-ylbutyl]cyclohexan-1-ol (PubChem CID 21241517) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)-4-piperazin-1-ylbutyl]cyclohexan-1-ol.
| Compound Name | 1-[1-(4-methoxyphenyl)-4-piperazin-1-ylbutyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 21241517 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)-4-piperazin-1-ylbutyl]cyclohexan-1-ol |
| SMILES | COc1ccc(C(CCCN2CCNCC2)C2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C21H34N2O2/c1-25-19-9-7-18(8-10-19)20(21(24)11-3-2-4-12-21)6-5-15-23-16-13-22-14-17-23/h7-10,20,22,24H,2-6,11-17H2,1H3 |
| InChIKey | WAHDFELQJYKUOB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |