C17H28ClNO2 — CID 162517103
[3-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propyl]-methylazanium chloride (PubChem CID 162517103) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is [3-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propyl]-methylazanium chloride.
| Compound Name | [3-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propyl]-methylazanium chloride |
|---|---|
| PubChem CID | 162517103 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [3-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propyl]-methylazanium chloride |
| SMILES | C[NH2+]CCC(c1ccc(OC)cc1)C1(O)CCCCC1.[Cl-] |
| InChI | InChI=1S/C17H27NO2.ClH/c1-18-13-10-16(17(19)11-4-3-5-12-17)14-6-8-15(20-2)9-7-14;/h6-9,16,18-19H,3-5,10-13H2,1-2H3;1H |
| InChIKey | HRMJJQWYIYHTDY-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |