C17H28AsClO2 — CID 87689305
1-[2-dimethylarsanyl-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride (PubChem CID 87689305) has the molecular formula C17H28AsClO2 and a molecular weight of 374.78 g/mol. Its IUPAC name is 1-[2-dimethylarsanyl-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[2-dimethylarsanyl-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 87689305 |
| Molecular Formula | C17H28AsClO2 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[2-dimethylarsanyl-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
| SMILES | COc1ccc(C(C[As](C)C)C2(O)CCCCC2)cc1.Cl |
| InChI | InChI=1S/C17H27AsO2.ClH/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14;/h7-10,16,19H,4-6,11-13H2,1-3H3;1H |
| InChIKey | UUHCOZBTHLGXPB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|