C16H21NO2 — CID 59807280
1-[2,2-dideuterio-2-isocyano-1-[4-(trideuteriomethoxy)phenyl]ethyl]cyclohexan-1-ol (PubChem CID 59807280) has the molecular formula C16H21NO2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-[2,2-dideuterio-2-isocyano-1-[4-(trideuteriomethoxy)phenyl]ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2,2-dideuterio-2-isocyano-1-[4-(trideuteriomethoxy)phenyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 59807280 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-[2,2-dideuterio-2-isocyano-1-[4-(trideuteriomethoxy)phenyl]ethyl]cyclohexan-1-ol |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C(C2(O)CCCCC2)C([2H])([2H])[N+]#[C-])cc1 |
| InChI | InChI=1S/C16H21NO2/c1-17-12-15(16(18)10-4-3-5-11-16)13-6-8-14(19-2)9-7-13/h6-9,15,18H,3-5,10-12H2,2H3/i2D3,12D2 |
| InChIKey | VKVYHCIMCOBGAO-VTNORMIGSA-N |
| XLogP | 3.39 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|