C34H55ClN2O4 — CID 68818348
bis(1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol);hydrochloride (PubChem CID 68818348) has the molecular formula C34H55ClN2O4 and a molecular weight of 591.28 g/mol. Its IUPAC name is bis(1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol);hydrochloride.
| Compound Name | bis(1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol);hydrochloride |
|---|---|
| PubChem CID | 68818348 |
| Molecular Formula | C34H55ClN2O4 |
| Molecular Weight | 591.28 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | bis(1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol);hydrochloride |
| SMILES | COc1ccc(C(CN(C)C)C2(O)CCCCC2)cc1.COc1ccc(C(CN(C)C)C2(O)CCCCC2)cc1.Cl |
| InChI | InChI=1S/2C17H27NO2.ClH/c2*1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14;/h2*7-10,16,19H,4-6,11-13H2,1-3H3;1H |
| InChIKey | VKVGMSHNPHNSKD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.28 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |