C15H24ClNO2 — CID 68843793
1-[2-amino-2-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride (PubChem CID 68843793) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-[2-amino-2-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[2-amino-2-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 68843793 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[2-amino-2-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
| SMILES | COc1ccc(C(N)CC2(O)CCCCC2)cc1.Cl |
| InChI | InChI=1S/C15H23NO2.ClH/c1-18-13-7-5-12(6-8-13)14(16)11-15(17)9-3-2-4-10-15;/h5-8,14,17H,2-4,9-11,16H2,1H3;1H |
| InChIKey | GEIVFFBKCNRDAY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |