C9H15ClN2O — CID 70626122
1-(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 70626122) has the molecular formula C9H15ClN2O and a molecular weight of 202.69 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | 1-(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 70626122 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1ccc(C(N)CN)cc1.Cl |
| InChI | InChI=1S/C9H14N2O.ClH/c1-12-8-4-2-7(3-5-8)9(11)6-10;/h2-5,9H,6,10-11H2,1H3;1H |
| InChIKey | UXPFKXQKCNXBNY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |