C11H16N2O3 — CID 129462911
(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid (PubChem CID 129462911) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid.
| Compound Name | (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 129462911 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid |
| SMILES | COc1ccc([C@@H](N)C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C11H16N2O3/c1-16-8-4-2-7(3-5-8)9(12)6-10(13)11(14)15/h2-5,9-10H,6,12-13H2,1H3,(H,14,15)/t9-,10-/m0/s1 |
| InChIKey | MFPGGPHTGGNYLI-UWVGGRQHSA-N |
| XLogP | 0.50 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |