(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid

C11H16N2O3 — CID 129462911

IUPAC(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid
SMILESCOc1ccc([C@@H](N)C[C@H](N)C(=O)O)cc1
InChIInChI=1S/C11H16N2O3/c1-16-8-4-2-7(3-5-8)9(12)6-10(13)11(14)15/h2-5,9-10H,6,12-13H2,1H3,(H,14,15)/t9-,10-/m0/s1
InChIKeyMFPGGPHTGGNYLI-UWVGGRQHSA-N
MW224.26 g/mol
LogP0.50
Rot. Bonds5

About (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid

(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid (PubChem CID 129462911) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid.

Molecular Properties

Compound Name(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid
PubChem CID129462911
Molecular FormulaC11H16N2O3
Molecular Weight224.26 g/mol
Exact Mass224.12
IUPAC Name(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid
SMILESCOc1ccc([C@@H](N)C[C@H](N)C(=O)O)cc1
InChIInChI=1S/C11H16N2O3/c1-16-8-4-2-7(3-5-8)9(12)6-10(13)11(14)15/h2-5,9-10H,6,12-13H2,1H3,(H,14,15)/t9-,10-/m0/s1
InChIKeyMFPGGPHTGGNYLI-UWVGGRQHSA-N
XLogP0.50
TPSA98.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 50.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid?
The IUPAC name of (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid (CID 129462911) is (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid.
What is the SMILES notation for (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid?
The canonical SMILES for (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid is COc1ccc([C@@H](N)C[C@H](N)C(=O)O)cc1.
What is the InChIKey of (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid?
The InChIKey is MFPGGPHTGGNYLI-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-16-8-4-2-7(3-5-8)9(12)6-10(13)11(14)15/h2-5,9-10H,6,12-13H2,1H3,(H,14,15)/t9-,10-/m0/s1.
What are the key properties of (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid?
(2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid has a molecular weight of 224.26 g/mol, XLogP of 0.50, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2,4-diamino-4-(4-methoxyphenyl)butanoic acid is sourced from PubChem (CID 129462911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).