C11H16ClNO3 — CID 71757574
4-amino-4-(4-methoxyphenyl)butanoic acid;hydrochloride (PubChem CID 71757574) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 4-amino-4-(4-methoxyphenyl)butanoic acid;hydrochloride.
| Compound Name | 4-amino-4-(4-methoxyphenyl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 71757574 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-amino-4-(4-methoxyphenyl)butanoic acid;hydrochloride |
| SMILES | COc1ccc(C(N)CCC(=O)O)cc1.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H |
| InChIKey | YRDCMFROILVZJR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |