About (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride
(4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride (PubChem CID 171338117) has the molecular formula C9H14Cl2N2O2
and a molecular weight of 253.13 g/mol. Its IUPAC name is (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride |
| PubChem CID | 171338117 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@H](CCC(=O)O)c1ccncc1 |
| InChI | InChI=1S/C9H12N2O2.2ClH/c10-8(1-2-9(12)13)7-3-5-11-6-4-7;;/h3-6,8H,1-2,10H2,(H,12,13);2*1H/t8-;;/m1../s1 |
| InChIKey | IUBJMVHZMYESAT-YCBDHFTFSA-N |
| XLogP | 1.79 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride?
The IUPAC name of (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride (CID 171338117) is (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride.
What is the SMILES notation for (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride?
The canonical SMILES for (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride is Cl.Cl.N[C@H](CCC(=O)O)c1ccncc1.
What is the InChIKey of (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride?
The InChIKey is IUBJMVHZMYESAT-YCBDHFTFSA-N. The full InChI is InChI=1S/C9H12N2O2.2ClH/c10-8(1-2-9(12)13)7-3-5-11-6-4-7;;/h3-6,8H,1-2,10H2,(H,12,13);2*1H/t8-;;/m1../s1.
What are the key properties of (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride?
(4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride has a molecular weight of 253.13 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride is sourced from PubChem (CID 171338117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).