(4R)-4-amino-5-pyridin-4-ylpentanoic acid

C10H14N2O2 — CID 66644679

IUPAC(4R)-4-amino-5-pyridin-4-ylpentanoic acid
SMILESN[C@H](CCC(=O)O)Cc1ccncc1
InChIInChI=1S/C10H14N2O2/c11-9(1-2-10(13)14)7-8-3-5-12-6-4-8/h3-6,9H,1-2,7,11H2,(H,13,14)/t9-/m1/s1
InChIKeyXFJPDZYZMUSYBA-SECBINFHSA-N
MW194.23 g/mol
LogP0.82
Rot. Bonds5

About (4R)-4-amino-5-pyridin-4-ylpentanoic acid

(4R)-4-amino-5-pyridin-4-ylpentanoic acid (PubChem CID 66644679) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (4R)-4-amino-5-pyridin-4-ylpentanoic acid.

Molecular Properties

Compound Name(4R)-4-amino-5-pyridin-4-ylpentanoic acid
PubChem CID66644679
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name(4R)-4-amino-5-pyridin-4-ylpentanoic acid
SMILESN[C@H](CCC(=O)O)Cc1ccncc1
InChIInChI=1S/C10H14N2O2/c11-9(1-2-10(13)14)7-8-3-5-12-6-4-8/h3-6,9H,1-2,7,11H2,(H,13,14)/t9-/m1/s1
InChIKeyXFJPDZYZMUSYBA-SECBINFHSA-N
XLogP0.82
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (4R)-4-amino-5-pyridin-4-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(4R)-4-amino-5-(4-aminophenyl)pentanoic acid
CID 66644557
4-amino-5-(4-tert-butylphenyl)pentanoic acid
CID 62961688
2-(2-pyridin-4-yl-1-sulfanylethyl)pentanedioic acid
CID 22460665
4-amino-5-[4-(dimethylamino)phenyl]pentanoic acid
CID 55154057
(4R)-4-amino-5-[4-(diaminomethylideneamino)phenyl]pentanoic acid
CID 66644748
(4R)-4-amino-4-pyridin-4-ylbutanoic acid;dihydrochloride
CID 171338117
(4R)-4-amino-5-(3-aminophenyl)pentanoic acid
CID 66644797
(3S)-3-amino-2-oxo-4-pyridin-4-ylbutanoic acid
CID 169109798
4-amino-5-oxo-5-(2-pyridin-4-ylethylamino)pentanoic acid
CID 64890850
acetic acid;3-pyridin-4-ylpropanoic acid
CID 71346900
5-amino-6-phenylhexan-2-one
CID 90094782
1-pyridin-4-ylhex-5-yn-2-amine
CID 63642414

Frequently Asked Questions

What is the IUPAC name of (4R)-4-amino-5-pyridin-4-ylpentanoic acid?
The IUPAC name of (4R)-4-amino-5-pyridin-4-ylpentanoic acid (CID 66644679) is (4R)-4-amino-5-pyridin-4-ylpentanoic acid.
What is the SMILES notation for (4R)-4-amino-5-pyridin-4-ylpentanoic acid?
The canonical SMILES for (4R)-4-amino-5-pyridin-4-ylpentanoic acid is N[C@H](CCC(=O)O)Cc1ccncc1.
What is the InChIKey of (4R)-4-amino-5-pyridin-4-ylpentanoic acid?
The InChIKey is XFJPDZYZMUSYBA-SECBINFHSA-N. The full InChI is InChI=1S/C10H14N2O2/c11-9(1-2-10(13)14)7-8-3-5-12-6-4-8/h3-6,9H,1-2,7,11H2,(H,13,14)/t9-/m1/s1.
What are the key properties of (4R)-4-amino-5-pyridin-4-ylpentanoic acid?
(4R)-4-amino-5-pyridin-4-ylpentanoic acid has a molecular weight of 194.23 g/mol, XLogP of 0.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-5-pyridin-4-ylpentanoic acid is sourced from PubChem (CID 66644679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).