C12H15NO4S — CID 22460665
2-(2-pyridin-4-yl-1-sulfanylethyl)pentanedioic acid (PubChem CID 22460665) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(2-pyridin-4-yl-1-sulfanylethyl)pentanedioic acid.
| Compound Name | 2-(2-pyridin-4-yl-1-sulfanylethyl)pentanedioic acid |
|---|---|
| PubChem CID | 22460665 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(2-pyridin-4-yl-1-sulfanylethyl)pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)C(S)Cc1ccncc1 |
| InChI | InChI=1S/C12H15NO4S/c14-11(15)2-1-9(12(16)17)10(18)7-8-3-5-13-6-4-8/h3-6,9-10,18H,1-2,7H2,(H,14,15)(H,16,17) |
| InChIKey | VCJLJGAXLGKZIO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|