C11H14NO6P — CID 18403085
2-[[hydroxy(pyridin-4-yl)phosphoryl]methyl]pentanedioic acid (PubChem CID 18403085) has the molecular formula C11H14NO6P and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[[hydroxy(pyridin-4-yl)phosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[hydroxy(pyridin-4-yl)phosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 18403085 |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[[hydroxy(pyridin-4-yl)phosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)c1ccncc1)C(=O)O |
| InChI | InChI=1S/C11H14NO6P/c13-10(14)2-1-8(11(15)16)7-19(17,18)9-3-5-12-6-4-9/h3-6,8H,1-2,7H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | HJDHHXUMBDCJHS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|