C12H14FO6P — CID 151105625
2-[[(2-fluorophenyl)-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 151105625) has the molecular formula C12H14FO6P and a molecular weight of 304.21 g/mol. Its IUPAC name is 2-[[(2-fluorophenyl)-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[(2-fluorophenyl)-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 151105625 |
| Molecular Formula | C12H14FO6P |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[[(2-fluorophenyl)-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C12H14FO6P/c13-9-3-1-2-4-10(9)20(18,19)7-8(12(16)17)5-6-11(14)15/h1-4,8H,5-7H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | MPAWFRNWRJOTLF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|