C21H20NO8P — CID 22460598
2-[[[(1,3-dioxoisoindol-2-yl)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 22460598) has the molecular formula C21H20NO8P and a molecular weight of 445.36 g/mol. Its IUPAC name is 2-[[[(1,3-dioxoisoindol-2-yl)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[(1,3-dioxoisoindol-2-yl)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 22460598 |
| Molecular Formula | C21H20NO8P |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[[[(1,3-dioxoisoindol-2-yl)-phenylmethyl]-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(=O)(O)C(c1ccccc1)N1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C21H20NO8P/c23-17(24)11-10-14(21(27)28)12-31(29,30)20(13-6-2-1-3-7-13)22-18(25)15-8-4-5-9-16(15)19(22)26/h1-9,14,20H,10-12H2,(H,23,24)(H,27,28)(H,29,30) |
| InChIKey | PFOFSASIKBTXBY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|