C13H12N2O6 — CID 175505324
2-[(1,3-dioxoisoindol-2-yl)amino]pentanedioic acid (PubChem CID 175505324) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)amino]pentanedioic acid.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 175505324 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C13H12N2O6/c16-10(17)6-5-9(13(20)21)14-15-11(18)7-3-1-2-4-8(7)12(15)19/h1-4,9,14H,5-6H2,(H,16,17)(H,20,21) |
| InChIKey | QESRTQOQGXRUDW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|