C12H16NO5P — CID 141452800
(2S)-2-[[benzyl(hydroxy)phosphanyl]amino]pentanedioic acid (PubChem CID 141452800) has the molecular formula C12H16NO5P and a molecular weight of 285.24 g/mol. Its IUPAC name is (2S)-2-[[benzyl(hydroxy)phosphanyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[benzyl(hydroxy)phosphanyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 141452800 |
| Molecular Formula | C12H16NO5P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2S)-2-[[benzyl(hydroxy)phosphanyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NP(O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16NO5P/c14-11(15)7-6-10(12(16)17)13-19(18)8-9-4-2-1-3-5-9/h1-5,10,13,18H,6-8H2,(H,14,15)(H,16,17)/t10-,19?/m0/s1 |
| InChIKey | JMWFZSDRLGPPFA-IHBJSSOOSA-N |
| XLogP | 1.40 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|