C17H23O7P — CID 139457437
2-[[(2-carboxy-4-phenylbutyl)-hydroxyphosphanyl]methyl]pentanedioic acid (PubChem CID 139457437) has the molecular formula C17H23O7P and a molecular weight of 370.34 g/mol. Its IUPAC name is 2-[[(2-carboxy-4-phenylbutyl)-hydroxyphosphanyl]methyl]pentanedioic acid.
| Compound Name | 2-[[(2-carboxy-4-phenylbutyl)-hydroxyphosphanyl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 139457437 |
| Molecular Formula | C17H23O7P |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[[(2-carboxy-4-phenylbutyl)-hydroxyphosphanyl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(O)CC(CCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23O7P/c18-15(19)9-8-14(17(22)23)11-25(24)10-13(16(20)21)7-6-12-4-2-1-3-5-12/h1-5,13-14,24H,6-11H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | PUSUTGKYHFWUSA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|