C24H29NO5 — CID 14557712
4-(2-carboxyethylcarbamoyl)-6-phenyl-2-(2-phenylethyl)hexanoic acid (PubChem CID 14557712) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-(2-carboxyethylcarbamoyl)-6-phenyl-2-(2-phenylethyl)hexanoic acid.
| Compound Name | 4-(2-carboxyethylcarbamoyl)-6-phenyl-2-(2-phenylethyl)hexanoic acid |
|---|---|
| PubChem CID | 14557712 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-(2-carboxyethylcarbamoyl)-6-phenyl-2-(2-phenylethyl)hexanoic acid |
| SMILES | O=C(O)CCNC(=O)C(CCc1ccccc1)CC(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H29NO5/c26-22(27)15-16-25-23(28)20(13-11-18-7-3-1-4-8-18)17-21(24(29)30)14-12-19-9-5-2-6-10-19/h1-10,20-21H,11-17H2,(H,25,28)(H,26,27)(H,29,30) |
| InChIKey | CSNTXZULZKKKHM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |