3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid

C25H25NO3 — CID 68910081

IUPAC3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid
SMILESO=C(O)CCNC(=O)c1ccccc1CCC(c1ccccc1)c1ccccc1
InChIInChI=1S/C25H25NO3/c27-24(28)17-18-26-25(29)23-14-8-7-13-21(23)15-16-22(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22H,15-18H2,(H,26,29)(H,27,28)
InChIKeyNXGYYSLFSYJEDW-UHFFFAOYSA-N
MW387.48 g/mol
LogP4.66
Rot. Bonds9

About 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid

3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid (PubChem CID 68910081) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid.

Molecular Properties

Compound Name3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid
PubChem CID68910081
Molecular FormulaC25H25NO3
Molecular Weight387.48 g/mol
Exact Mass387.18
IUPAC Name3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid
SMILESO=C(O)CCNC(=O)c1ccccc1CCC(c1ccccc1)c1ccccc1
InChIInChI=1S/C25H25NO3/c27-24(28)17-18-26-25(29)23-14-8-7-13-21(23)15-16-22(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22H,15-18H2,(H,26,29)(H,27,28)
InChIKeyNXGYYSLFSYJEDW-UHFFFAOYSA-N
XLogP4.66
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500387.48
LogP ≤ 54.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid?
The IUPAC name of 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid (CID 68910081) is 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid.
What is the SMILES notation for 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid?
The canonical SMILES for 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid is O=C(O)CCNC(=O)c1ccccc1CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid?
The InChIKey is NXGYYSLFSYJEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3/c27-24(28)17-18-26-25(29)23-14-8-7-13-21(23)15-16-22(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22H,15-18H2,(H,26,29)(H,27,28).
What are the key properties of 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid?
3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid has a molecular weight of 387.48 g/mol, XLogP of 4.66, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid is sourced from PubChem (CID 68910081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).