C25H25NO3 — CID 68910081
3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid (PubChem CID 68910081) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid.
| Compound Name | 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68910081 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[[2-(3,3-diphenylpropyl)benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccccc1CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c27-24(28)17-18-26-25(29)23-14-8-7-13-21(23)15-16-22(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,22H,15-18H2,(H,26,29)(H,27,28) |
| InChIKey | NXGYYSLFSYJEDW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |