C38H36N2O2 — CID 5181795
1-N,4-N-bis(3,3-diphenylpropyl)benzene-1,4-dicarboxamide (PubChem CID 5181795) has the molecular formula C38H36N2O2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 1-N,4-N-bis(3,3-diphenylpropyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(3,3-diphenylpropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5181795 |
| Molecular Formula | C38H36N2O2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 1-N,4-N-bis(3,3-diphenylpropyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)c1ccc(C(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H36N2O2/c41-37(39-27-25-35(29-13-5-1-6-14-29)30-15-7-2-8-16-30)33-21-23-34(24-22-33)38(42)40-28-26-36(31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-24,35-36H,25-28H2,(H,39,41)(H,40,42) |
| InChIKey | RXWFWXIKVBSSOS-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |