C25H27NO3 — CID 2399652
N-(3,3-diphenylpropyl)-3,5-dimethoxy-4-methylbenzamide (PubChem CID 2399652) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-(3,3-diphenylpropyl)-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 2399652 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(3,3-diphenylpropyl)-3,5-dimethoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)NCCC(c2ccccc2)c2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C25H27NO3/c1-18-23(28-2)16-21(17-24(18)29-3)25(27)26-15-14-22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,16-17,22H,14-15H2,1-3H3,(H,26,27) |
| InChIKey | DBRNNKRDBOOTNJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |