C34H32N2O2 — CID 4579764
N-(3,3-diphenylpropyl)-1-(2-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 4579764) has the molecular formula C34H32N2O2 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-1-(2-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-1-(2-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 4579764 |
| Molecular Formula | C34H32N2O2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-(3,3-diphenylpropyl)-1-(2-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | COc1ccccc1-n1c(-c2ccccc2)cc(C(=O)NCCC(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C34H32N2O2/c1-25-30(24-32(28-18-10-5-11-19-28)36(25)31-20-12-13-21-33(31)38-2)34(37)35-23-22-29(26-14-6-3-7-15-26)27-16-8-4-9-17-27/h3-21,24,29H,22-23H2,1-2H3,(H,35,37) |
| InChIKey | NQQAVMAZZFGJHB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|