C23H25ClN2O2 — CID 7295044
N-[(2R)-butan-2-yl]-5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methylpyrrole-3-carboxamide (PubChem CID 7295044) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 7295044 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-(4-chlorophenyl)-1-(2-methoxyphenyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccccc2OC)c1C |
| InChI | InChI=1S/C23H25ClN2O2/c1-5-15(2)25-23(27)19-14-21(17-10-12-18(24)13-11-17)26(16(19)3)20-8-6-7-9-22(20)28-4/h6-15H,5H2,1-4H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | JQHZVGRSGVYUPT-OAHLLOKOSA-N |
| XLogP | 5.64 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|