C28H28N2O2 — CID 46126484
N-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 46126484) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46126484 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | CCOc1ccccc1-n1c(-c2ccccc2)cc(C(=O)Nc2ccc(C)c(C)c2)c1C |
| InChI | InChI=1S/C28H28N2O2/c1-5-32-27-14-10-9-13-25(27)30-21(4)24(18-26(30)22-11-7-6-8-12-22)28(31)29-23-16-15-19(2)20(3)17-23/h6-18H,5H2,1-4H3,(H,29,31) |
| InChIKey | WGVWLKDKTVKLTE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|