C27H30N2O4 — CID 42665678
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone (PubChem CID 42665678) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone.
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 42665678 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-(2-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]methanone |
| SMILES | CCOc1ccccc1-n1c(-c2ccccc2)cc(C(=O)N2CCC3(CC2)OCCO3)c1C |
| InChI | InChI=1S/C27H30N2O4/c1-3-31-25-12-8-7-11-23(25)29-20(2)22(19-24(29)21-9-5-4-6-10-21)26(30)28-15-13-27(14-16-28)32-17-18-33-27/h4-12,19H,3,13-18H2,1-2H3 |
| InChIKey | NQQJUMJJDJJBNP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|