C26H32N3O2+ — CID 7230572
[1-(4-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone (PubChem CID 7230572) has the molecular formula C26H32N3O2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [1-(4-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 7230572 |
| Molecular Formula | C26H32N3O2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [1-(4-ethoxyphenyl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone |
| SMILES | CCOc1ccc(-n2c(-c3ccccc3)cc(C(=O)N3CC[NH+](CC)CC3)c2C)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-4-27-15-17-28(18-16-27)26(30)24-19-25(21-9-7-6-8-10-21)29(20(24)3)22-11-13-23(14-12-22)31-5-2/h6-14,19H,4-5,15-18H2,1-3H3/p+1 |
| InChIKey | GGORDVKLZRRKLT-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|