C26H28N2O3 — CID 42785349
ethyl 1-(2-methyl-1,5-diphenylpyrrole-3-carbonyl)piperidine-3-carboxylate (PubChem CID 42785349) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 1-(2-methyl-1,5-diphenylpyrrole-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2-methyl-1,5-diphenylpyrrole-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42785349 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | ethyl 1-(2-methyl-1,5-diphenylpyrrole-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(-c3ccccc3)n(-c3ccccc3)c2C)C1 |
| InChI | InChI=1S/C26H28N2O3/c1-3-31-26(30)21-13-10-16-27(18-21)25(29)23-17-24(20-11-6-4-7-12-20)28(19(23)2)22-14-8-5-9-15-22/h4-9,11-12,14-15,17,21H,3,10,13,16,18H2,1-2H3 |
| InChIKey | KBZZZUOZTBBXJJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|